CAS 898168-15-5 is the registry number for HI042. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(5-nitrothiophen-2-yl)methylideneamino]-3-phenylprop-2-enamide (CAS 898168-15-5) is a chemical compound with the molecular formula C14H11N3O3S and a molecular weight of 301.32 g/mol. IUPAC name: N-[(5-nitrothiophen-2-yl)methylideneamino]-3-phenylprop-2-enamide. InChIKey: UFDGCRPZQXOYCS-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O3S |
|---|---|
| Molecular weight | 301.32 g/mol |
| IUPAC name | N-[(5-nitrothiophen-2-yl)methylideneamino]-3-phenylprop-2-enamide |
| InChIKey | UFDGCRPZQXOYCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=CC(=O)NN=CC2=CC=C(S2)[N+](=O)[O-] |
Computed by PubChem (NCBI)