Products 2955561-64-3
CAS 2955561-64-3 is the registry number for TERT-BUTYL 9-OXO-2-OXA-6-AZASPIRO[3.5]NONANE-6-CARBOXYLATE, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl 5-oxo-2-oxa-8-azaspiro[3.5]nonane-8-carboxylate (CAS 2955561-64-3) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: tert-butyl 5-oxo-2-oxa-8-azaspiro[3.5]nonane-8-carboxylate. InChIKey: OILHCLUGALOJMJ-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | tert-butyl 5-oxo-2-oxa-8-azaspiro[3.5]nonane-8-carboxylate |
| InChIKey | OILHCLUGALOJMJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C2(C1)COC2 |
Computed by PubChem (NCBI)