Products 29574-57-0

CAS 29574-57-0 appears in our catalog under these names: 1,2–bis(2–naphthyl)ethan–1,2–dione, 1,2-Di(naphthalen-2-yl)ethane-1,2-dione 97%, 1,2-Di(naphthalen-2-yl)ethane-1,2-dione, 95%, 95%, 1,2-bis(2-naphthyl)ethan-1,2-dione, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

1,2-dinaphthalen-2-ylethane-1,2-dione (CAS 29574-57-0) is a chemical compound with the molecular formula C22H14O2 and a molecular weight of 310.3 g/mol. IUPAC name: 1,2-dinaphthalen-2-ylethane-1,2-dione. InChIKey: CUUMQBIJNWGQLU-UHFFFAOYSA-N.

Identity
Molecular formulaC22H14O2
Molecular weight310.3 g/mol
IUPAC name1,2-dinaphthalen-2-ylethane-1,2-dione
InChIKeyCUUMQBIJNWGQLU-UHFFFAOYSA-N
SMILESC1=CC=C2C=C(C=CC2=C1)C(=O)C(=O)C3=CC4=CC=CC=C4C=C3

Computed by PubChem (NCBI)