CAS 3457-41-8 appears in our catalog under these names: 1,2–di(naphthalen–1–yl)ethane–1,2–dione, 1,2-Di(naphthalen-1-yl)ethane-1,2-dione, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 25g, 100mg, 250mg, 1g, 5g.
1,2-dinaphthalen-1-ylethane-1,2-dione (CAS 3457-41-8) is a chemical compound with the molecular formula C22H14O2 and a molecular weight of 310.3 g/mol. IUPAC name: 1,2-dinaphthalen-1-ylethane-1,2-dione. InChIKey: BBWHFKLQXLXHNI-UHFFFAOYSA-N.
| Molecular formula | C22H14O2 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 1,2-dinaphthalen-1-ylethane-1,2-dione |
| InChIKey | BBWHFKLQXLXHNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)