Products 2969456-88-8
CAS 2969456-88-8 is the registry number for 1-(2-bromo-5-chloropyridin-4-yl)cyclopentanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2-bromo-5-chloro-4-pyridinyl)cyclopentan-1-ol (CAS 2969456-88-8) is a chemical compound with the molecular formula C10H11BrClNO and a molecular weight of 276.56 g/mol. IUPAC name: 1-(2-bromo-5-chloro-4-pyridinyl)cyclopentan-1-ol. InChIKey: KPYGTNGVNLNMDG-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClNO |
|---|---|
| Molecular weight | 276.56 g/mol |
| IUPAC name | 1-(2-bromo-5-chloro-4-pyridinyl)cyclopentan-1-ol |
| InChIKey | KPYGTNGVNLNMDG-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC(=NC=C2Cl)Br)O |
Computed by PubChem (NCBI)