CAS 297756-30-0 is the registry number for 6-Vinylindolin-2-one, 97% mix TBC as stabilizer. Offered by: Chemat Brand. Available pack sizes: on request.
6-ethenyl-1,3-dihydroindol-2-one (CAS 297756-30-0) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 6-ethenyl-1,3-dihydroindol-2-one. InChIKey: WXVYKTAZLTZJSZ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 6-ethenyl-1,3-dihydroindol-2-one |
| InChIKey | WXVYKTAZLTZJSZ-UHFFFAOYSA-N |
| SMILES | C=CC1=CC2=C(CC(=O)N2)C=C1 |
Computed by PubChem (NCBI)