Products 297756-30-0

CAS 297756-30-0 is the registry number for 6-Vinylindolin-2-one, 97% mix TBC as stabilizer. Offered by: Chemat Brand. Available pack sizes: on request.

6-ethenyl-1,3-dihydroindol-2-one (CAS 297756-30-0) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 6-ethenyl-1,3-dihydroindol-2-one. InChIKey: WXVYKTAZLTZJSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO
Molecular weight159.18 g/mol
IUPAC name6-ethenyl-1,3-dihydroindol-2-one
InChIKeyWXVYKTAZLTZJSZ-UHFFFAOYSA-N
SMILESC=CC1=CC2=C(CC(=O)N2)C=C1

Computed by PubChem (NCBI)