Products 2982740-93-0
CAS 2982740-93-0 is the registry number for 2-((3-Chloropyridin-2-yl)oxy)ethanamine dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[(3-chloro-2-pyridinyl)oxy]ethanamine;dihydrochloride (CAS 2982740-93-0) is a chemical compound with the molecular formula C7H11Cl3N2O and a molecular weight of 245.5 g/mol. IUPAC name: 2-[(3-chloro-2-pyridinyl)oxy]ethanamine;dihydrochloride. InChIKey: LTUWXQGRYNBFKX-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl3N2O |
|---|---|
| Molecular weight | 245.5 g/mol |
| IUPAC name | 2-[(3-chloro-2-pyridinyl)oxy]ethanamine;dihydrochloride |
| InChIKey | LTUWXQGRYNBFKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OCCN)Cl.Cl.Cl |
Computed by PubChem (NCBI)