CAS 1803583-87-0 appears in our catalog under these names: 3-(2-Aminoethoxy)-5-chloropyridine dihydrochloride, 98%, 3-(2-Aminoethoxy)-5-chloropyridine dihydrochloride, 2-((5-Chloropyridin-3-yl)oxy)ethan-1-amine dihydrochloride, 98%. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 10g, 0,5g, 50mg, 100mg.
2-[(5-chloro-3-pyridinyl)oxy]ethanamine;dihydrochloride (CAS 1803583-87-0) is a chemical compound with the molecular formula C7H11Cl3N2O and a molecular weight of 245.5 g/mol. IUPAC name: 2-[(5-chloro-3-pyridinyl)oxy]ethanamine;dihydrochloride. InChIKey: AANGACWPCXIVSA-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl3N2O |
|---|---|
| Molecular weight | 245.5 g/mol |
| IUPAC name | 2-[(5-chloro-3-pyridinyl)oxy]ethanamine;dihydrochloride |
| InChIKey | AANGACWPCXIVSA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Cl)OCCN.Cl.Cl |
Computed by PubChem (NCBI)