Products 2938997-70-5

CAS 2938997-70-5 is the registry number for 2-[(4-chloropyridin-2-yl)oxy]ethan-1-amine dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(4-chloro-2-pyridinyl)oxy]ethanamine;dihydrochloride (CAS 2938997-70-5) is a chemical compound with the molecular formula C7H11Cl3N2O and a molecular weight of 245.5 g/mol. IUPAC name: 2-[(4-chloro-2-pyridinyl)oxy]ethanamine;dihydrochloride. InChIKey: PZTBFEUAGWEGHP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11Cl3N2O
Molecular weight245.5 g/mol
IUPAC name2-[(4-chloro-2-pyridinyl)oxy]ethanamine;dihydrochloride
InChIKeyPZTBFEUAGWEGHP-UHFFFAOYSA-N
SMILESC1=CN=C(C=C1Cl)OCCN.Cl.Cl

Computed by PubChem (NCBI)