CAS 2682097-44-3 is the registry number for (R)-2-Amino-2-(4-chloropyridin-2-yl)ethanol dihydrochloride, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-2-(4-chloro-2-pyridinyl)ethanol;dihydrochloride (CAS 2682097-44-3) is a chemical compound with the molecular formula C7H11Cl3N2O and a molecular weight of 245.5 g/mol. IUPAC name: (2R)-2-amino-2-(4-chloro-2-pyridinyl)ethanol;dihydrochloride. InChIKey: KRVZBMSYEFYFML-ILKKLZGPSA-N.
| Molecular formula | C7H11Cl3N2O |
|---|---|
| Molecular weight | 245.5 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-chloro-2-pyridinyl)ethanol;dihydrochloride |
| InChIKey | KRVZBMSYEFYFML-ILKKLZGPSA-N |
| SMILES | C1=CN=C(C=C1Cl)[C@H](CO)N.Cl.Cl |
Computed by PubChem (NCBI)