Products 2983060-44-0
CAS 2983060-44-0 is the registry number for (2,3,4,5,6-pentadeuteriophenyl)methanamine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2,3,4,5,6-pentadeuteriophenyl)methanamine;hydrochloride (CAS 2983060-44-0) is a chemical compound with the molecular formula C7H10ClN and a molecular weight of 148.64 g/mol. IUPAC name: (2,3,4,5,6-pentadeuteriophenyl)methanamine;hydrochloride. InChIKey: XKXHCNPAFAXVRZ-GWVWGMRQSA-N.
| Molecular formula | C7H10ClN |
|---|---|
| Molecular weight | 148.64 g/mol |
| IUPAC name | (2,3,4,5,6-pentadeuteriophenyl)methanamine;hydrochloride |
| InChIKey | XKXHCNPAFAXVRZ-GWVWGMRQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CN)[2H])[2H].Cl |
Computed by PubChem (NCBI)