CAS 352431-27-7 appears in our catalog under these names: Benzyl-d7-amine HCl, 99 atom % D, min 98% Chemical Purity, Phenylmethanamine-d7 (Hydrochloride). Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
Dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methanamine;hydrochloride (CAS 352431-27-7) is a chemical compound with the molecular formula C7H10ClN and a molecular weight of 150.66 g/mol. IUPAC name: dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methanamine;hydrochloride. InChIKey: XKXHCNPAFAXVRZ-BVSNMZCWSA-N.
| Molecular formula | C7H10ClN |
|---|---|
| Molecular weight | 150.66 g/mol |
| IUPAC name | dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methanamine;hydrochloride |
| InChIKey | XKXHCNPAFAXVRZ-BVSNMZCWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])N)[2H])[2H].Cl |
Computed by PubChem (NCBI)