Products 2987004-95-3
CAS 2987004-95-3 is the registry number for HbF inducer-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(2-acetyl-2-azaspiro[3.3]heptan-6-yl)-3-phenyl-1,2-oxazole-5-carboxamide (CAS 2987004-95-3) is a chemical compound with the molecular formula C18H19N3O3 and a molecular weight of 325.4 g/mol. IUPAC name: N-(2-acetyl-2-azaspiro[3.3]heptan-6-yl)-3-phenyl-1,2-oxazole-5-carboxamide. InChIKey: IUWTWZMRWOKWGL-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | N-(2-acetyl-2-azaspiro[3.3]heptan-6-yl)-3-phenyl-1,2-oxazole-5-carboxamide |
| InChIKey | IUWTWZMRWOKWGL-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2(C1)CC(C2)NC(=O)C3=CC(=NO3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
HbF inducer-1