CAS 298710-86-8 is the registry number for 4,4’-Dithiobis(3,5-bis(1,1-dimethylethyl)-phenol. Offered by: TRC. Available pack sizes: 100mg.
3,5-ditert-butyl-4-[(2,6-ditert-butyl-4-hydroxyphenyl)disulfanyl]phenol (CAS 298710-86-8) is a chemical compound with the molecular formula C28H42O2S2 and a molecular weight of 474.8 g/mol. IUPAC name: 3,5-ditert-butyl-4-[(2,6-ditert-butyl-4-hydroxyphenyl)disulfanyl]phenol. InChIKey: CMQMROYESLJHFA-UHFFFAOYSA-N.
| Molecular formula | C28H42O2S2 |
|---|---|
| Molecular weight | 474.8 g/mol |
| IUPAC name | 3,5-ditert-butyl-4-[(2,6-ditert-butyl-4-hydroxyphenyl)disulfanyl]phenol |
| InChIKey | CMQMROYESLJHFA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1SSC2=C(C=C(C=C2C(C)(C)C)O)C(C)(C)C)C(C)(C)C)O |
Computed by PubChem (NCBI)