CAS 29873-99-2 appears in our catalog under these names: gamma-Elemene, γ-Elemene. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
Cis-(1R,2R)-1-ethenyl-1-methyl-4-propan-2-ylidene-2-prop-1-en-2-ylcyclohexane (CAS 29873-99-2) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: cis-(1R,2R)-1-ethenyl-1-methyl-4-propan-2-ylidene-2-prop-1-en-2-ylcyclohexane. InChIKey: BQSLMQNYHVFRDT-CABCVRRESA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | cis-(1R,2R)-1-ethenyl-1-methyl-4-propan-2-ylidene-2-prop-1-en-2-ylcyclohexane |
| InChIKey | BQSLMQNYHVFRDT-CABCVRRESA-N |
| SMILES | CC(=C1CC[C@]([C@H](C1)C(=C)C)(C)C=C)C |
Computed by PubChem (NCBI)