Products 2987962-31-0
CAS 2987962-31-0 is the registry number for 1-(2,2,2-trifluoroethyl)-6-vinyl-1H-indazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg.
6-ethenyl-1-(2,2,2-trifluoroethyl)indazole (CAS 2987962-31-0) is a chemical compound with the molecular formula C11H9F3N2 and a molecular weight of 226.20 g/mol. IUPAC name: 6-ethenyl-1-(2,2,2-trifluoroethyl)indazole. InChIKey: BCDOSFZTRVPLDT-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 6-ethenyl-1-(2,2,2-trifluoroethyl)indazole |
| InChIKey | BCDOSFZTRVPLDT-UHFFFAOYSA-N |
| SMILES | C=CC1=CC2=C(C=C1)C=NN2CC(F)(F)F |
Computed by PubChem (NCBI)