CAS 29900-75-2 is the registry number for N-HYDROXYCINNAMAMIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
(E)-N-hydroxy-3-phenylprop-2-enamide (CAS 29900-75-2) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (E)-N-hydroxy-3-phenylprop-2-enamide. InChIKey: UVDDFTZLVFIQFL-VOTSOKGWSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (E)-N-hydroxy-3-phenylprop-2-enamide |
| InChIKey | UVDDFTZLVFIQFL-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NO |
Computed by PubChem (NCBI)