CAS 2990170-46-0 is the registry number for (R)-2-([1,1'-Biphenyl]-3-yl)-2-aminoethan-1-ol hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2R)-2-amino-2-(3-phenylphenyl)ethanol;hydrochloride (CAS 2990170-46-0) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: (2R)-2-amino-2-(3-phenylphenyl)ethanol;hydrochloride. InChIKey: BXGCRUFKCAYARR-UQKRIMTDSA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-phenylphenyl)ethanol;hydrochloride |
| InChIKey | BXGCRUFKCAYARR-UQKRIMTDSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)