Products 2990548-08-6
CAS 2990548-08-6 is the registry number for 2-(4-Fluoro-2-methylphenyl)propan-2-amine hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(4-fluoro-2-methylphenyl)propan-2-amine;hydrochloride (CAS 2990548-08-6) is a chemical compound with the molecular formula C10H15ClFN and a molecular weight of 203.68 g/mol. IUPAC name: 2-(4-fluoro-2-methylphenyl)propan-2-amine;hydrochloride. InChIKey: ZWXFNSMMVVYTQE-UHFFFAOYSA-N.
| Molecular formula | C10H15ClFN |
|---|---|
| Molecular weight | 203.68 g/mol |
| IUPAC name | 2-(4-fluoro-2-methylphenyl)propan-2-amine;hydrochloride |
| InChIKey | ZWXFNSMMVVYTQE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)C(C)(C)N.Cl |
Computed by PubChem (NCBI)