CAS 29938-70-3 is the registry number for 4-Benzoyl-5-chloro-1,3-dimethyl-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 250mg.
(5-chloro-1,3-dimethylpyrazol-4-yl)-phenylmethanone (CAS 29938-70-3) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: (5-chloro-1,3-dimethylpyrazol-4-yl)-phenylmethanone. InChIKey: ZJXIONUUCMIROS-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | (5-chloro-1,3-dimethylpyrazol-4-yl)-phenylmethanone |
| InChIKey | ZJXIONUUCMIROS-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C(=O)C2=CC=CC=C2)Cl)C |
Computed by PubChem (NCBI)