CAS 642946-02-9 is the registry number for 1-(4-Nitrilophenyl)-3-(4-methylbenzoyl)thiourea. Offered by: Biosynth. Available pack sizes: 5000mg.
N-[(4-cyanophenyl)carbamothioyl]-4-methylbenzamide (CAS 642946-02-9) is a chemical compound with the molecular formula C16H13N3OS and a molecular weight of 295.4 g/mol. IUPAC name: N-[(4-cyanophenyl)carbamothioyl]-4-methylbenzamide. InChIKey: QZXSGEYUOFRABS-UHFFFAOYSA-N.
| Molecular formula | C16H13N3OS |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | N-[(4-cyanophenyl)carbamothioyl]-4-methylbenzamide |
| InChIKey | QZXSGEYUOFRABS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)NC(=S)NC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)