CAS 29970-01-2 appears in our catalog under these names: 4-Ethoxy-1H-indole-2-carboxylic acid, 98%, 4-Ethoxy-1H-indole-2-carboxylic acid 95%, 4-ETHOXY-1H-INDOLE-2-CARBOXYLIC ACID, 95%, 4-Ethoxy-1h-indole-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 500mg.
4-ethoxy-1H-indole-2-carboxylic acid (CAS 29970-01-2) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 4-ethoxy-1H-indole-2-carboxylic acid. InChIKey: LJWIZTFZBBEWOJ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 4-ethoxy-1H-indole-2-carboxylic acid |
| InChIKey | LJWIZTFZBBEWOJ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC2=C1C=C(N2)C(=O)O |
Computed by PubChem (NCBI)