CAS 299953-00-7 appears in our catalog under these names: Mirin, 95+%, Mirin, 95% , MRN-ATM Pathway Inhibitor, Mirin, Mirin 99%, MRN-ATM Pathway Inhibitor, M 1PC X 10MG. Offered by: AmBeed, Thermo Scientific (Alfa Aesar), Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5mg, 10mg, 50mg, 0,5g, 2g, 100mg, 250mg.
(5Z)-2-amino-5-[(4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one (CAS 299953-00-7) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: (5Z)-2-amino-5-[(4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one. InChIKey: YBHQCJILTOVLHD-YVMONPNESA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | (5Z)-2-amino-5-[(4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one |
| InChIKey | YBHQCJILTOVLHD-YVMONPNESA-N |
| SMILES | C1=CC(=CC=C1/C=C\2/C(=O)N=C(S2)N)O |
Computed by PubChem (NCBI)