Products 3002437-96-6
CAS 3002437-96-6 is the registry number for 2-bromo-1-methyl-4-(4-nitrophenoxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-1-methyl-4-(4-nitrophenoxy)benzene (CAS 3002437-96-6) is a chemical compound with the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. IUPAC name: 2-bromo-1-methyl-4-(4-nitrophenoxy)benzene. InChIKey: AIZXFHDVZOPJTH-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO3 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 2-bromo-1-methyl-4-(4-nitrophenoxy)benzene |
| InChIKey | AIZXFHDVZOPJTH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=CC=C(C=C2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)