Products 300576-59-4
CAS 300576-59-4 appears in our catalog under these names: (+)-PD 128907 hydrochloride/ 98.71% (existing batch purity), (+)–PD 128907 hydrochloride, (+)-PD 128907 hydrochloride, (+)-PD 128970 HCl, 98%, 98%, (+)-PD 128907 hydrochloride, 98.92%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
(4aR,10bR)-4-propyl-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-9-ol;hydrochloride (CAS 300576-59-4) is a chemical compound with the molecular formula C14H20ClNO3 and a molecular weight of 285.76 g/mol. IUPAC name: (4aR,10bR)-4-propyl-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-9-ol;hydrochloride. InChIKey: DCFXOTRONMKUJB-QMDUSEKHSA-N.
| Molecular formula | C14H20ClNO3 |
|---|---|
| Molecular weight | 285.76 g/mol |
| IUPAC name | (4aR,10bR)-4-propyl-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-9-ol;hydrochloride |
| InChIKey | DCFXOTRONMKUJB-QMDUSEKHSA-N |
| SMILES | CCCN1CCO[C@H]2[C@H]1COC3=C2C=C(C=C3)O.Cl |
Computed by PubChem (NCBI)