CAS 3006789-98-3 is the registry number for N-Nitroso Sertraline, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 50mg.
N-[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylnitrous amide (CAS 3006789-98-3) is a chemical compound with the molecular formula C17H16Cl2N2O and a molecular weight of 335.2 g/mol. IUPAC name: N-[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylnitrous amide. InChIKey: JSJQTSRHWMIRDB-SJCJKPOMSA-N.
| Molecular formula | C17H16Cl2N2O |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | N-[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylnitrous amide |
| InChIKey | JSJQTSRHWMIRDB-SJCJKPOMSA-N |
| SMILES | CN([C@H]1CC[C@H](C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl)N=O |
Computed by PubChem (NCBI)