Products 329079-65-4
CAS 329079-65-4 is the registry number for N-(3,4-dichlorophenyl)-2-(1,2,3,4-tetrahydroquinolyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(3,4-dichlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)acetamide (CAS 329079-65-4) is a chemical compound with the molecular formula C17H16Cl2N2O and a molecular weight of 335.2 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)acetamide. InChIKey: OEEAYBNRQYPWRB-UHFFFAOYSA-N.
| Molecular formula | C17H16Cl2N2O |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)acetamide |
| InChIKey | OEEAYBNRQYPWRB-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2N(C1)CC(=O)NC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)