Products 51037-88-8
CAS 51037-88-8 is the registry number for Tuclazepam. Offered by: MedChemExpress. Available pack sizes: Get quote.
[7-chloro-5-(2-chlorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-2-yl]methanol (CAS 51037-88-8) is a chemical compound with the molecular formula C17H16Cl2N2O and a molecular weight of 335.2 g/mol. IUPAC name: [7-chloro-5-(2-chlorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-2-yl]methanol. InChIKey: OOESZOOEEZGPST-UHFFFAOYSA-N.
| Molecular formula | C17H16Cl2N2O |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | [7-chloro-5-(2-chlorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-2-yl]methanol |
| InChIKey | OOESZOOEEZGPST-UHFFFAOYSA-N |
| SMILES | CN1C(CN=C(C2=C1C=CC(=C2)Cl)C3=CC=CC=C3Cl)CO |
Computed by PubChem (NCBI)