Products 3006789-99-4
CAS 3006789-99-4 is the registry number for 4-[(1R)-1-Hydroxy-2-(methylnitrosoamino)ethyl]-1,2-benzenediol, 95%. Offered by: Chemat. Available pack sizes: 100mg.
N-[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-N-methylnitrous amide (CAS 3006789-99-4) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: N-[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-N-methylnitrous amide. InChIKey: JTRMEPRMRSMNNE-VIFPVBQESA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | N-[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-N-methylnitrous amide |
| InChIKey | JTRMEPRMRSMNNE-VIFPVBQESA-N |
| SMILES | CN(C[C@@H](C1=CC(=C(C=C1)O)O)O)N=O |
Computed by PubChem (NCBI)