CAS 300691-07-0 is the registry number for 5,7-Dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid (CAS 300691-07-0) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid. InChIKey: NJJMZMNKPOVXQM-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
| InChIKey | NJJMZMNKPOVXQM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=CC(=NN12)C(=O)O)C |
Computed by PubChem (NCBI)