Products 300691-07-0

CAS 300691-07-0 is the registry number for 5,7-Dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid (CAS 300691-07-0) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid. InChIKey: NJJMZMNKPOVXQM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9N3O2
Molecular weight191.19 g/mol
IUPAC name5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid
InChIKeyNJJMZMNKPOVXQM-UHFFFAOYSA-N
SMILESCC1=CC(=NC2=CC(=NN12)C(=O)O)C

Computed by PubChem (NCBI)