Products 300713-78-4

CAS 300713-78-4 is the registry number for 4-[(2-Fluorophenyl)carbonylamino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[(2-fluorobenzoyl)amino]benzoic acid (CAS 300713-78-4) is a chemical compound with the molecular formula C14H10FNO3 and a molecular weight of 259.23 g/mol. IUPAC name: 4-[(2-fluorobenzoyl)amino]benzoic acid. InChIKey: FZJCDIMBKJXQMN-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10FNO3
Molecular weight259.23 g/mol
IUPAC name4-[(2-fluorobenzoyl)amino]benzoic acid
InChIKeyFZJCDIMBKJXQMN-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)C(=O)O)F

Computed by PubChem (NCBI)