CAS 676494-56-7 is the registry number for 3–Fluoro–4–(4–formylphenoxy)benzamide. Offered by: GLPBio. Available pack sizes: 100mg.
3-fluoro-4-(4-formylphenoxy)benzamide (CAS 676494-56-7) is a chemical compound with the molecular formula C14H10FNO3 and a molecular weight of 259.23 g/mol. IUPAC name: 3-fluoro-4-(4-formylphenoxy)benzamide. InChIKey: NLRZKJKUWXRXFY-UHFFFAOYSA-N.
| Molecular formula | C14H10FNO3 |
|---|---|
| Molecular weight | 259.23 g/mol |
| IUPAC name | 3-fluoro-4-(4-formylphenoxy)benzamide |
| InChIKey | NLRZKJKUWXRXFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)OC2=C(C=C(C=C2)C(=O)N)F |
Computed by PubChem (NCBI)