CAS 349415-30-1 is the registry number for N-(4-Fluorophenyl)-2H-1,3-benzodioxole-5-carboxamide. Offered by: Biosynth. Available pack sizes: 2,5g.
N-(4-fluorophenyl)-1,3-benzodioxole-5-carboxamide (CAS 349415-30-1) is a chemical compound with the molecular formula C14H10FNO3 and a molecular weight of 259.23 g/mol. IUPAC name: N-(4-fluorophenyl)-1,3-benzodioxole-5-carboxamide. InChIKey: SKLOHUZEGQSTDR-UHFFFAOYSA-N.
| Molecular formula | C14H10FNO3 |
|---|---|
| Molecular weight | 259.23 g/mol |
| IUPAC name | N-(4-fluorophenyl)-1,3-benzodioxole-5-carboxamide |
| InChIKey | SKLOHUZEGQSTDR-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)NC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)