Products 300717-52-6
CAS 300717-52-6 is the registry number for 3,6-Bis(dimethylamino)-9H-thioxanthen-9-one 10,10-dioxide, 95%. Offered by: Chemat. Available pack sizes: 100mg.
3,6-bis(dimethylamino)-10,10-dioxothioxanthen-9-one (CAS 300717-52-6) is a chemical compound with the molecular formula C17H18N2O3S and a molecular weight of 330.4 g/mol. IUPAC name: 3,6-bis(dimethylamino)-10,10-dioxothioxanthen-9-one. InChIKey: KBGIKPMPVHGCPT-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O3S |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 3,6-bis(dimethylamino)-10,10-dioxothioxanthen-9-one |
| InChIKey | KBGIKPMPVHGCPT-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=O)C3=C(S2(=O)=O)C=C(C=C3)N(C)C |
Computed by PubChem (NCBI)