CAS 30100-16-4 appears in our catalog under these names: Boc–8–Aoc–OH, Boc-8-Aoc-OH, Boc-8-aoc-oh 97%, Boc-8-aoc-oh, 97%, 97%, N-Boc-8-amino-octanoic acid, 97.0%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 5g, 1g, 250mg, 25g, 100g, 500g, 10 g.
8-[(2-methylpropan-2-yl)oxycarbonylamino]octanoic acid (CAS 30100-16-4) is a chemical compound with the molecular formula C13H25NO4 and a molecular weight of 259.34 g/mol. IUPAC name: 8-[(2-methylpropan-2-yl)oxycarbonylamino]octanoic acid. InChIKey: FPRZYWCRQHFPSX-UHFFFAOYSA-N.
| Molecular formula | C13H25NO4 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | 8-[(2-methylpropan-2-yl)oxycarbonylamino]octanoic acid |
| InChIKey | FPRZYWCRQHFPSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCC(=O)O |
Computed by PubChem (NCBI)