Products 301221-56-7
CAS 301221-56-7 is the registry number for 1,1-Dimethylethyl 4-(1-hydroxy-2-nitroethyl)-1-piperidinecarboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 4-(1-hydroxy-2-nitroethyl)piperidine-1-carboxylate (CAS 301221-56-7) is a chemical compound with the molecular formula C12H22N2O5 and a molecular weight of 274.31 g/mol. IUPAC name: tert-butyl 4-(1-hydroxy-2-nitroethyl)piperidine-1-carboxylate. InChIKey: UVHHOQRLAPSWNR-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O5 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | tert-butyl 4-(1-hydroxy-2-nitroethyl)piperidine-1-carboxylate |
| InChIKey | UVHHOQRLAPSWNR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(C[N+](=O)[O-])O |
Computed by PubChem (NCBI)