CAS 3016-97-5 appears in our catalog under these names: 1,4–Dibenzoylbenzene, 1,4-Dibenzoylbenzene, >98.0%(GC), 1,4-Dibenzoylbenzene 98%, 1,4-DIBENZOYLBENZENE, 99%, 1,4-Dibenzoylbenzene, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 25g, 5g, 10g, 1g.
(4-benzoylphenyl)-phenylmethanone (CAS 3016-97-5) is a chemical compound with the molecular formula C20H14O2 and a molecular weight of 286.3 g/mol. IUPAC name: (4-benzoylphenyl)-phenylmethanone. InChIKey: NPENBPVOAXERED-UHFFFAOYSA-N.
| Molecular formula | C20H14O2 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | (4-benzoylphenyl)-phenylmethanone |
| InChIKey | NPENBPVOAXERED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)