Products 30163-88-3

CAS 30163-88-3 is the registry number for 3-(1H-Benzimidazol-1-yl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 50g, 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

3-(benzimidazol-1-yl)propanoic acid;hydrochloride (CAS 30163-88-3) is a chemical compound with the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. IUPAC name: 3-(benzimidazol-1-yl)propanoic acid;hydrochloride. InChIKey: DAVWSJSWUOVUFG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClN2O2
Molecular weight226.66 g/mol
IUPAC name3-(benzimidazol-1-yl)propanoic acid;hydrochloride
InChIKeyDAVWSJSWUOVUFG-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)N=CN2CCC(=O)O.Cl

Computed by PubChem (NCBI)