Products 3017268-48-0

CAS 3017268-48-0 is the registry number for O-Desvenlafaxine Impurity D. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

N-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]-N-methylnitrous amide (CAS 3017268-48-0) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: N-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]-N-methylnitrous amide. InChIKey: UBWZUHCQDQPKDF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22N2O3
Molecular weight278.35 g/mol
IUPAC nameN-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]-N-methylnitrous amide
InChIKeyUBWZUHCQDQPKDF-UHFFFAOYSA-N
SMILESCN(CC(C1=CC=C(C=C1)O)C2(CCCCC2)O)N=O

Computed by PubChem (NCBI)