Products 3023062-95-2

CAS 3023062-95-2 is the registry number for tert-butyl 2,9-diazadispiro[3.2.3⁷.2⁴]dodecane-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 2,9-diazadispiro[3.2.37.24]dodecane-9-carboxylate (CAS 3023062-95-2) is a chemical compound with the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. IUPAC name: tert-butyl 2,9-diazadispiro[3.2.37.24]dodecane-9-carboxylate. InChIKey: HTISKBDEKUUBSR-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26N2O2
Molecular weight266.38 g/mol
IUPAC nametert-butyl 2,9-diazadispiro[3.2.37.24]dodecane-9-carboxylate
InChIKeyHTISKBDEKUUBSR-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2(C1)CCC3(CC2)CNC3

Computed by PubChem (NCBI)