CAS 30253-44-2 appears in our catalog under these names: 3,4–EDMC (hydrochloride), 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-(methylamino)propan-1-one, hydrochloride, 3,4-EDMC (hydrochloride). Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg, 10 mg, 5 mg, 25 mg.
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(methylamino)propan-1-one;hydrochloride (CAS 30253-44-2) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(methylamino)propan-1-one;hydrochloride. InChIKey: ICPYGVDJAZJHBA-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(methylamino)propan-1-one;hydrochloride |
| InChIKey | ICPYGVDJAZJHBA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC2=C(C=C1)OCCO2)NC.Cl |
Computed by PubChem (NCBI)