Products 3026677-04-0
CAS 3026677-04-0 appears in our catalog under these names: 5-Cyano-4-cyclobutyl-2-methylbenzoic acid, 98%, 5-Cyano-4-cyclobutyl-2-methylbenzoic acid, 98%, 98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
5-cyano-4-cyclobutyl-2-methylbenzoic acid (CAS 3026677-04-0) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 5-cyano-4-cyclobutyl-2-methylbenzoic acid. InChIKey: HXNMXAZRIYICGK-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 5-cyano-4-cyclobutyl-2-methylbenzoic acid |
| InChIKey | HXNMXAZRIYICGK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)C#N)C2CCC2 |
Computed by PubChem (NCBI)