CAS 3027-38-1 appears in our catalog under these names: 3-Nitro-1,8-naphthalic Anhydride, >95% (HPLC), 3-Nitro-1,8-naphthalic anhydride, 3-Nitro-1,8-naphthalic anhydride, 98%, 5-Nitrobenzo[de]isochromene-1,3-dione 98%, 5-Nitrobenzo[de]isochromene-1,3-dione, 98%, 98%. Offered by: TRC, Biosynth, Thermo Scientific (Acros), Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 25g, 100g, 500g, 50g, 250g.
7-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 3027-38-1) is a chemical compound with the molecular formula C12H5NO5 and a molecular weight of 243.17 g/mol. IUPAC name: 7-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: FLFLZYYDLIKGJQ-UHFFFAOYSA-N.
| Molecular formula | C12H5NO5 |
|---|---|
| Molecular weight | 243.17 g/mol |
| IUPAC name | 7-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | FLFLZYYDLIKGJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC3=C2C(=C1)C(=O)OC3=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)