CAS 6642-29-1 appears in our catalog under these names: 4–Nitro–1,8–naphthalic anhydride, 6-Nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione, >95.0%(HPLC)(T), 6-Nitrobenzo[de]isochromene-1,3-dione 95%, 4-NITRO-1,8-NAPHTHALIC ANHYDRIDE, 95%, 4-Nitro-1,8-naphthalic anhydride, 95%, 95%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 25g, 5g, 10g.
8-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 6642-29-1) is a chemical compound with the molecular formula C12H5NO5 and a molecular weight of 243.17 g/mol. IUPAC name: 8-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: LKOZHLXUWUBRDK-UHFFFAOYSA-N.
| Molecular formula | C12H5NO5 |
|---|---|
| Molecular weight | 243.17 g/mol |
| IUPAC name | 8-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | LKOZHLXUWUBRDK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)OC3=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)