CAS 34087-02-0 appears in our catalog under these names: 4-Nitrobenzo[de]isochromene-1,3-dione, 95%, 2-Nitro-1,8-naphthalic anhydride, 4-Nitrobenzo[de]isochromene-1,3-dione 97%, 4-Nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione, 97%, 97%, 4-Nitrobenzo[de]isochromene-1,3-dione, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 50g, 100mg, 250mg.
6-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione (CAS 34087-02-0) is a chemical compound with the molecular formula C12H5NO5 and a molecular weight of 243.17 g/mol. IUPAC name: 6-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione. InChIKey: QLYSDTXUBZEOII-UHFFFAOYSA-N.
| Molecular formula | C12H5NO5 |
|---|---|
| Molecular weight | 243.17 g/mol |
| IUPAC name | 6-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
| InChIKey | QLYSDTXUBZEOII-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)OC(=O)C3=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)