CAS 302788-80-3 is the registry number for 8-Phenyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-phenyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline (CAS 302788-80-3) is a chemical compound with the molecular formula C14H10N4O and a molecular weight of 250.25 g/mol. IUPAC name: 8-phenyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline. InChIKey: OYSHBJLBHAYFAK-UHFFFAOYSA-N.
| Molecular formula | C14H10N4O |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 8-phenyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline |
| InChIKey | OYSHBJLBHAYFAK-UHFFFAOYSA-N |
| SMILES | C1CC2=NON=C2C3=CC(=NN=C31)C4=CC=CC=C4 |
Computed by PubChem (NCBI)