CAS 874605-79-5 is the registry number for 4-Hydroxy-6-phenyl-2-(pyrazin-2-yl)pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
4-phenyl-2-pyrazin-2-yl-1H-pyrimidin-6-one (CAS 874605-79-5) is a chemical compound with the molecular formula C14H10N4O and a molecular weight of 250.25 g/mol. IUPAC name: 4-phenyl-2-pyrazin-2-yl-1H-pyrimidin-6-one. InChIKey: KRRPZHCPLYVAGX-UHFFFAOYSA-N.
| Molecular formula | C14H10N4O |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 4-phenyl-2-pyrazin-2-yl-1H-pyrimidin-6-one |
| InChIKey | KRRPZHCPLYVAGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)NC(=N2)C3=NC=CN=C3 |
Computed by PubChem (NCBI)