CAS 436086-85-0 is the registry number for 2-(1H-Benzoimidazol-5-yl)-benzooxazol-5-ylamine. Offered by: Biosynth. Available pack sizes: 250mg.
2-(3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine (CAS 436086-85-0) is a chemical compound with the molecular formula C14H10N4O and a molecular weight of 250.25 g/mol. IUPAC name: 2-(3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine. InChIKey: ZGDMZBQVYDRREE-UHFFFAOYSA-N.
| Molecular formula | C14H10N4O |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 2-(3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine |
| InChIKey | ZGDMZBQVYDRREE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C3=NC4=C(O3)C=CC(=C4)N)NC=N2 |
Computed by PubChem (NCBI)