Products 3029269-96-0
CAS 3029269-96-0 is the registry number for 5,5'-(Buta-1,3-diyne-1,4-diyl)diisophthalaldehyde, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-[4-(3,5-diformylphenyl)buta-1,3-diynyl]benzene-1,3-dicarbaldehyde (CAS 3029269-96-0) is a chemical compound with the molecular formula C20H10O4 and a molecular weight of 314.3 g/mol. IUPAC name: 5-[4-(3,5-diformylphenyl)buta-1,3-diynyl]benzene-1,3-dicarbaldehyde. InChIKey: ACFZRFYWNQNSDE-UHFFFAOYSA-N.
| Molecular formula | C20H10O4 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 5-[4-(3,5-diformylphenyl)buta-1,3-diynyl]benzene-1,3-dicarbaldehyde |
| InChIKey | ACFZRFYWNQNSDE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C=O)C#CC#CC2=CC(=CC(=C2)C=O)C=O)C=O |
Computed by PubChem (NCBI)