Products 3029550-24-8
CAS 3029550-24-8 appears in our catalog under these names: CSNK2A–IN–1, CSNK2A-IN-1, 99.44%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 50 mg, 10 mg, 25 mg, 5 mg.
4-[6-(2-methoxy-5-propan-2-yloxyanilino)pyrazin-2-yl]benzoic acid (CAS 3029550-24-8) is a chemical compound with the molecular formula C21H21N3O4 and a molecular weight of 379.4 g/mol. IUPAC name: 4-[6-(2-methoxy-5-propan-2-yloxyanilino)pyrazin-2-yl]benzoic acid. InChIKey: YITHRAGTKVMJPO-UHFFFAOYSA-N.
| Molecular formula | C21H21N3O4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 4-[6-(2-methoxy-5-propan-2-yloxyanilino)pyrazin-2-yl]benzoic acid |
| InChIKey | YITHRAGTKVMJPO-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C=C1)OC)NC2=NC(=CN=C2)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)